CAS 10103-89-6
:2,3-Quinoxalinedimethanol, 2,3-diacetate, 1,4-dioxide
Description:
2,3-Quinoxalinedimethanol, 2,3-diacetate, 1,4-dioxide, identified by CAS number 10103-89-6, is a chemical compound that features a quinoxaline core structure, which is a bicyclic compound containing two nitrogen atoms in the aromatic ring. This substance is characterized by the presence of two hydroxymethyl groups and two acetate groups, contributing to its reactivity and solubility in various solvents. The 1,4-dioxide functionality indicates the presence of an additional oxygen atom in the ring, which can influence the compound's chemical behavior, including its potential as a ligand in coordination chemistry. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of multiple functional groups allows for diverse chemical modifications, enhancing its utility in synthetic applications. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C14H14N2O6
InChI:InChI=1S/C14H14N2O6/c1-9(17)21-7-13-14(8-22-10(2)18)16(20)12-6-4-3-5-11(12)15(13)19/h3-6H,7-8H2,1-2H3
InChI key:InChIKey=UPTLHMUHWUBHKR-UHFFFAOYSA-N
SMILES:C(OC(C)=O)C=1C(COC(C)=O)=N(=O)C2=C(N1=O)C=CC=C2
Synonyms:- 2,3-Bis(acetoxymethyl)quinoxaline 1,4-dioxide
- 2,3-Bis(acetoxymethyl)quinoxaline1,4-dioxide
- 2,3-Di(acetoxymethyl)quinoxaline di-N-oxide
- 2,3-Quinoxalinedimethanol, 2,3-diacetate, 1,4-dioxide
- 2,3-Quinoxalinedimethanol, diacetate (ester), 1,4-dioxide
- 2,3-Quinoxalinedimethanol, diacetate, 1,4-dioxide
- 2,3-bis[(acetyloxy)methyl]-1-oxoquinoxalin-1-ium-4(1H)-olate
- Chinoxidin
- Quinoxidine
- [3-(Acetoxymethyl)-1,4-dioxido-quinoxaline-1,4-diium-2-yl]methyl acetate
- [3-(Acetyloxymethyl)-4-Oxido-1-Oxo-Quinoxalin-2-Yl]Methyl Acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Quinoxidine (Chinoxidin)
CAS:Formula:C14H14N2O6Color and Shape:White To Off-White SolidMolecular weight:306.272,3-Bis[(acetyloxy)methyl]-1-oxoquinoxalin-1-ium-4(1H)-olate
CAS:<p>2,3-Bis[(acetyloxy)methyl]-1-oxoquinoxalin--1-ium-4(1H)-olate is a benzimidazole derivative that has been used in the treatment of bone diseases such as osteoporosis and Paget's disease. It is also used for the treatment of Alzheimer's disease, nasal polyps, and endometrial cancer. It inhibits bacterial growth by interfering with the synthesis of DNA. 2,3-Bis[(acetyloxy)methyl]-1-oxoquinoxalin--1-ium-4(1H)-olate binds to bone tissue and inhibits the production of chloride ions by binding to chloride channels on cells in tissues. This leads to a decrease in pH levels and prevents bacterial growth. 2,3-Bis[(acetyloxy)methyl]-1-oxoquinoxalin--1-ium-4(1H)-olate also blocks the activity of bacterial</p>Formula:C14H14N2O6Purity:Min. 95%Color and Shape:PowderMolecular weight:306.27 g/mol2,3-Bis[(acetyloxy)methyl]-1-oxoquinoxalin-1-ium-4(1H)-olate
CAS:Controlled Product<p>Applications 2,3-Bis[(acetyloxy)methyl]-1-oxoquinoxalin-1-ium-4(1H)-olate is an antibiotic.<br>References Marrero-Ponce, Yovani, et al.: Bioorg. & Med. Chem., 13(8), 2881-2899 (2005)<br></p>Formula:C14H14N2O6Color and Shape:NeatMolecular weight:306.27


