CAS 101038-93-1

L-gamma-glutamyl-N-[S-(1H-indol-3-ylmethyl)-L-cysteinyl]glycine

Description:

L-gamma-glutamyl-N-[S-(1H-indol-3-ylmethyl)-L-cysteinyl]glycine, with CAS number 101038-93-1, is a synthetic peptide that features a unique combination of amino acids, including glutamic acid, cysteine, and glycine, along with an indole moiety. This compound is characterized by its potential biological activity, particularly in the context of neurochemistry and pharmacology, where it may influence neurotransmitter systems or exhibit antioxidant properties. The presence of the indole group suggests possible interactions with serotonin receptors, which could be relevant for mood regulation and cognitive functions. Additionally, the cysteine residue may contribute to the formation of disulfide bonds, impacting the stability and conformation of the peptide. Its structure indicates that it may be soluble in polar solvents, and its biological activity could be influenced by factors such as pH and temperature. Overall, this compound represents a fascinating area of study for researchers interested in peptide chemistry and its applications in medicinal chemistry.

Formula: C₁₉H₂₄N₄O₆S

InChI: InChI=1/C19H24N4O6S/c20-13(19(28)29)5-6-16(24)23(8-17(25)26)18(27)14(21)10-30-9-11-7-22-15-4-2-1-3-12(11)15/h1-4,7,13-14,22H,5-6,8-10,20-21H2,(H,25,26)(H,28,29)/t13-,14-/m0/s1

SMILES: c1ccc2c(c1)c(c[nH]2)CSC[C@@H](C(=O)N(CC(=O)O)C(=O)CC[C@@H](C(=O)O)N)N