CymitQuimica logo

CAS 1010386-65-8

:

1-(6-Azidohexyl)-1H-pyrrole-2,5-dione

Description:
1-(6-Azidohexyl)-1H-pyrrole-2,5-dione, identified by its CAS number 1010386-65-8, is a chemical compound that features a pyrrole ring substituted with an azidohexyl group. This compound is characterized by its unique structural framework, which includes a five-membered nitrogen-containing heterocycle (pyrrole) and a reactive azide functional group. The presence of the azido group imparts significant reactivity, making it useful in various applications, particularly in click chemistry and bioconjugation processes. The pyrrole moiety contributes to the compound's potential biological activity, as pyrrole derivatives are often explored for their pharmacological properties. Additionally, the compound's solubility, stability, and reactivity can be influenced by the length and nature of the hexyl chain. Overall, 1-(6-Azidohexyl)-1H-pyrrole-2,5-dione is of interest in synthetic organic chemistry and materials science, particularly for its potential in developing novel materials and bioactive compounds.
Formula:C10H14N4O2
InChI:InChI=1S/C10H14N4O2/c11-13-12-7-3-1-2-4-8-14-9(15)5-6-10(14)16/h5-6H,1-4,7-8H2
InChI key:InChIKey=MPCNERILHIJENI-UHFFFAOYSA-N
SMILES:C(CCCCCN=[N+]=[N-])N1C(=O)C=CC1=O
Synonyms:
  • 1-(6-Azidohexyl)-1H-pyrrole-2,5-dione
  • 1H-Pyrrole-2,5-dione, 1-(6-azidohexyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.