CymitQuimica logo

CAS 1010422-25-9

:

5-Bromo-N2-cyclopropyl-2,3-pyridinediamine

Description:
5-Bromo-N2-cyclopropyl-2,3-pyridinediamine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a cyclopropyl group. This compound features two amino groups, which contribute to its potential reactivity and solubility in various solvents. The presence of the bromine atom enhances its electrophilic character, making it useful in various synthetic applications, including medicinal chemistry and material science. The cyclopropyl moiety can influence the compound's biological activity and steric properties, potentially affecting its interaction with biological targets. Additionally, the compound's molecular structure suggests it may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its CAS number, 1010422-25-9, allows for easy identification and retrieval of information related to its properties, safety data, and applications in scientific literature. Overall, 5-Bromo-N2-cyclopropyl-2,3-pyridinediamine represents a versatile building block in organic synthesis and medicinal chemistry.
Formula:C8H10BrN3
InChI:InChI=1S/C8H10BrN3/c9-5-3-7(10)8(11-4-5)12-6-1-2-6/h3-4,6H,1-2,10H2,(H,11,12)
InChI key:InChIKey=ZCNVBYQYAOBKJB-UHFFFAOYSA-N
SMILES:N(C1=C(N)C=C(Br)C=N1)C2CC2
Synonyms:
  • 5-Bromo-N2-cyclopropyl-2,3-pyridinediamine
  • 2,3-Pyridinediamine, 5-bromo-N2-cyclopropyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.