CAS 1010422-42-0

N-[2-(4-Bromophenyl)ethyl]-2,2-difluoroacetamide

Description:

N-[2-(4-Bromophenyl)ethyl]-2,2-difluoroacetamide is a chemical compound characterized by its unique structure, which includes a difluoroacetamide functional group and a bromophenyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents, which can be attributed to its polar amide group and the presence of halogen atoms that influence its reactivity and interaction with other molecules. The bromine atom in the para position of the phenyl ring can enhance the compound's lipophilicity, potentially affecting its biological activity and pharmacokinetics. Additionally, the difluoroacetyl group may impart specific electronic properties, making it of interest in medicinal chemistry for the development of pharmaceuticals. The compound's molecular weight, melting point, and boiling point are influenced by its structural components, and it may undergo various chemical reactions typical of amides, such as hydrolysis or substitution. Overall, N-[2-(4-Bromophenyl)ethyl]-2,2-difluoroacetamide is a compound of interest in research and development, particularly in the fields of organic synthesis and drug discovery.

Formula: C₁₀H₁₀BrF₂NO

InChI: InChI=1S/C10H10BrF2NO/c11-8-3-1-7(2-4-8)5-6-14-10(15)9(12)13/h1-4,9H,5-6H2,(H,14,15)

InChI key: InChIKey=KTOYPCVEPWZYGC-UHFFFAOYSA-N

SMILES: C(CNC(C(F)F)=O)C1=CC=C(Br)C=C1

Synonyms:

• Acetamide, N-[2-(4-bromophenyl)ethyl]-2,2-difluoro-
• N-[2-(4-Bromophenyl)ethyl]-2,2-difluoroacetamide