CAS 101043-37-2
:microcystin lr
Description:
Microcystin LR is a potent cyclic peptide toxin produced by certain species of cyanobacteria, particularly Microcystis aeruginosa. It is known for its hepatotoxic effects, primarily targeting the liver and causing damage to liver cells. The structure of microcystin LR consists of a cyclic heptapeptide, which includes unique amino acids such as N-methyl-dehydroalanine and is characterized by a specific arrangement of these amino acids that contributes to its toxicity. This compound is highly soluble in water, which facilitates its bioavailability in aquatic environments. Microcystin LR is also resistant to heat and can persist in the environment, raising concerns for water quality and safety. Its presence in drinking water sources can pose significant health risks to humans and animals, leading to symptoms such as liver damage and gastrointestinal distress. Regulatory agencies monitor microcystin levels in water bodies to mitigate exposure risks, emphasizing the importance of understanding its characteristics and effects on health and ecosystems.
Formula:C49H74N10O12
InChI:InChI=1/C49H74N10O12/c1-26(2)23-37-46(66)58-40(48(69)70)30(6)42(62)55-35(17-14-22-52-49(50)51)45(65)54-34(19-18-27(3)24-28(4)38(71-10)25-33-15-12-11-13-16-33)29(5)41(61)56-36(47(67)68)20-21-39(60)59(9)32(8)44(64)53-31(7)43(63)57-37/h11-13,15-16,18-19,24,26,28-31,34-38,40H,8,14,17,20-23,25H2,1-7,9-10H3,(H,53,64)(H,54,65)(H,55,62)(H,56,61)(H,57,63)(H,58,66)(H,67,68)(H,69,70)(H4,50,51,52)/b19-18+,27-24+/t28-,29-,30-,31+,34-,35-,36+,37+,38-,40+/m0/s1
Synonyms:- Microcystin-LR, Microcystis aeruginosa
- (5R,8S,11R,12S,15S,18S,19S,22R)-15-{3-[(diaminomethylidene)amino]propyl}-18-[(1E,3E,5S,6S)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dien-1-yl]-1,5,12,19-tetramethyl-2-methylidene-8-(2-methylpropyl)-3,6,9,13,16,20,25-heptaoxo-1,4,7,10,14,17,21-heptaazacyclopentacosane-11,22-dicarboxylic acid
- (5R,8R,11R,12S,15S,18S,19S,22R)-15-{3-[(diaminomethylidene)amino]propyl}-18-[(1E,3E,5S,6S)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dien-1-yl]-1,5,12,19-tetramethyl-2-methylidene-8-(2-methylpropyl)-3,6,9,13,16,20,25-heptaoxo-1,4,7,10,14,17,21-heptaazacyclopentacosane-11,22-dicarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Microcystin-LR
CAS:Controlled Product<p>Microcystin-LR is a water-soluble metabolite of microcystin-RR. It is a potent inhibitor of protein synthesis and an inducer of apoptosis in mammalian cells. Microcystin-LR has been shown to inhibit the production of the proinflammatory cytokine tumor necrosis factor alpha (TNFα) in human monocytes. Microcystin-LR is a secondary metabolite that is isolated from cyanobacteria, which are also known as blue green algae. This compound can be found in plants, where it functions as a phytochemical. Microcystin-LR has been shown to have anti-inflammatory properties that may be due to its ability to inhibit prostaglandin synthesis.</p>Formula:C49H74N10O12Purity:Min. 95%Molecular weight:995.17 g/mol


