
CAS 101054-97-1
:(2R)-1,1,1-Trifluoro-2-butanol
Description:
(2R)-1,1,1-Trifluoro-2-butanol is a fluorinated alcohol characterized by the presence of three fluorine atoms attached to the first carbon of a butanol chain, which significantly influences its chemical properties. This compound is a chiral molecule, with the (2R) designation indicating its specific stereochemistry. It typically appears as a colorless liquid and is known for its high polarity due to the electronegative fluorine atoms, which enhance its hydrogen bonding capabilities. The trifluoromethyl group contributes to its unique reactivity, making it useful in various chemical syntheses and applications, particularly in the fields of pharmaceuticals and agrochemicals. Additionally, (2R)-1,1,1-Trifluoro-2-butanol exhibits low volatility and a relatively high boiling point compared to non-fluorinated alcohols, which can affect its handling and storage. Its distinct properties make it a subject of interest in both academic research and industrial applications, particularly in the development of fluorinated compounds.
Formula:C4H7F3O
InChI:InChI=1S/C4H7F3O/c1-2-3(8)4(5,6)7/h3,8H,2H2,1H3/t3-/m1/s1
InChI key:InChIKey=IBWNUWSYEJOUAH-GSVOUGTGSA-N
SMILES:[C@H](C(F)(F)F)(CC)O
Synonyms:- 2-Butanol, 1,1,1-trifluoro-, (2R)-
- (+)-1,1,1-Trifluoro-2-butyl alcohol
- (2R)-1,1,1-Trifluoro-2-butanol
- 2-Butanol, 1,1,1-trifluoro-, (R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
