CAS 101064-48-6
:MICROCYSTIN YR
Description:
Microcystin YR is a cyclic peptide toxin produced by certain species of cyanobacteria, particularly those in the genus Microcystis. It is known for its potent hepatotoxic effects, primarily affecting the liver and potentially leading to serious health issues in humans and animals upon exposure. The structure of Microcystin YR includes a unique arrangement of amino acids, contributing to its stability and toxicity. It is characterized by its ability to inhibit protein phosphatases, which disrupts cellular signaling pathways and can lead to cell death. Microcystin YR is soluble in water, which facilitates its spread in aquatic environments, particularly in freshwater systems where cyanobacterial blooms occur. Monitoring and managing the presence of Microcystin YR in water bodies is crucial due to its implications for public health and ecosystem integrity. Its detection typically involves advanced analytical techniques, such as high-performance liquid chromatography (HPLC) coupled with mass spectrometry, to ensure safety in drinking water and recreational areas.
Formula:C52H72N10O13
InChI:InChI=1/C52H72N10O13/c1-28(25-29(2)41(75-8)27-34-13-10-9-11-14-34)16-21-37-30(3)44(65)59-39(50(71)72)22-23-42(64)62(7)33(6)47(68)56-32(5)46(67)60-40(26-35-17-19-36(63)20-18-35)49(70)61-43(51(73)74)31(4)45(66)58-38(48(69)57-37)15-12-24-55-52(53)54/h9-11,13-14,16-21,25,29-32,37-41,43,63H,6,12,15,22-24,26-27H2,1-5,7-8H3,(H,56,68)(H,57,69)(H,58,66)(H,59,65)(H,60,67)(H,61,70)(H,71,72)(H,73,74)(H4,53,54,55)/b21-16+,28-25+/t29-,30-,31-,32+,37-,38-,39+,40+,41-,43+/m0/s1
Synonyms:- Microcystin Yr From Microcystis Aeruginosa
- Microcystin-Yr Solution
- (5R,8R,11R,12S,15S,18S,19S,22R)-15-{3-[(diaminomethylidene)amino]propyl}-8-(4-hydroxybenzyl)-18-[(1E,3E,5S,6S)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dien-1-yl]-1,5,12,19-tetramethyl-2-methylidene-3,6,9,13,16,20,25-heptaoxo-1,4,7,10,14,17,21-heptaazacyclopentacosane-11,22-dicarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Microcystin YR
CAS:Microcystin YR (Cyanoginosin YR) is a cyclic peptide and acts as an inhibitor of protein phosphatase 2A (PP2A).Formula:C52H72N10O13Color and Shape:SolidMolecular weight:1045.19Ref: 4Z-M-198006
Discontinued productMicrocystin-YR
CAS:Controlled ProductMicrocystin-YR is a polymerase chain inhibitor that blocks the production of RNA. It is used to diagnose cells with resistance to imatinib and dasatinib, which are drugs used in the treatment of chronic myeloid leukemia. Microcystin-YR also inhibits bcr-abl kinase, an enzyme involved in the production of RNA and DNA in cancer cells. This drug has been shown to cause cell lysis, or the breakdown of cells, and has been found to be effective against liver lesions caused by congestive heart failure and skin cancer. It has also been shown to inhibit cyclic peptide synthesis.
Formula:C52H72N10O13Purity:Min. 95%Molecular weight:1,045.19 g/mol


