CAS 101064-48-6: MICROCYSTIN YR
Description:Microcystin YR is a cyclic peptide toxin produced by certain species of cyanobacteria, particularly those in the genus Microcystis. It is known for its potent hepatotoxic effects, primarily affecting the liver and potentially leading to serious health issues in humans and animals upon exposure. The structure of Microcystin YR includes a unique arrangement of amino acids, contributing to its stability and toxicity. It is characterized by its ability to inhibit protein phosphatases, which disrupts cellular signaling pathways and can lead to cell death. Microcystin YR is soluble in water, which facilitates its spread in aquatic environments, particularly in freshwater systems where cyanobacterial blooms occur. Monitoring and managing the presence of Microcystin YR in water bodies is crucial due to its implications for public health and ecosystem integrity. Its detection typically involves advanced analytical techniques, such as high-performance liquid chromatography (HPLC) coupled with mass spectrometry, to ensure safety in drinking water and recreational areas.
Formula:C52H72N10O13
InChI:InChI=1/C52H72N10O13/c1-28(25-29(2)41(75-8)27-34-13-10-9-11-14-34)16-21-37-30(3)44(65)59-39(50(71)72)22-23-42(64)62(7)33(6)47(68)56-32(5)46(67)60-40(26-35-17-19-36(63)20-18-35)49(70)61-43(51(73)74)31(4)45(66)58-38(48(69)57-37)15-12-24-55-52(53)54/h9-11,13-14,16-21,25,29-32,37-41,43,63H,6,12,15,22-24,26-27H2,1-5,7-8H3,(H,56,68)(H,57,69)(H,58,66)(H,59,65)(H,60,67)(H,61,70)(H,71,72)(H,73,74)(H4,53,54,55)/b21-16+,28-25+/t29-,30-,31-,32+,37-,38-,39+,40+,41-,43+/m0/s1
- Synonyms:
- Microcystin Yr From Microcystis Aeruginosa
- Microcystin-Yr Solution
- (5R,8R,11R,12S,15S,18S,19S,22R)-15-{3-[(diaminomethylidene)amino]propyl}-8-(4-hydroxybenzyl)-18-[(1E,3E,5S,6S)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dien-1-yl]-1,5,12,19-tetramethyl-2-methylidene-3,6,9,13,16,20,25-heptaoxo-1,4,7,10,14,17,21-heptaazacyclopentacosane-11,22-dicarboxylic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Microcystin-YR REF: 4Z-M-198006CAS: 101064-48-6 | - - - | To inquire | Fri 21 Mar 25 |
![]() | Microcystin-YR REF: 3D-FM73137CAS: 101064-48-6 | Min. 95% | To inquire | Fri 25 Apr 25 |

Ref: 4Z-M-198006
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

Microcystin-YR
Controlled ProductRef: 3D-FM73137
1mg | To inquire | ||
2mg | To inquire | ||
250µg | To inquire | ||
500µg | To inquire |