CAS 101071-66-3

4-(methylthio)-6-piperidino-1,3,5-triazin-2-amine

Description:

4-(Methylthio)-6-piperidino-1,3,5-triazin-2-amine, with the CAS number 101071-66-3, is a chemical compound that belongs to the class of triazines, which are characterized by a six-membered ring containing three nitrogen atoms. This compound features a piperidine ring, which contributes to its potential biological activity, and a methylthio group that may influence its solubility and reactivity. The presence of the amino group indicates that it can participate in hydrogen bonding, making it potentially useful in various chemical reactions or as a ligand in coordination chemistry. Its structure suggests that it may exhibit properties relevant to pharmaceuticals or agrochemicals, although specific applications would depend on further research into its biological activity and stability. The compound's characteristics, such as melting point, solubility, and reactivity, would be determined through experimental methods, and safety data should be consulted for handling and usage.

Formula: C₉H₁₅N₅S

InChI: InChI=1/C9H15N5S/c1-15-9-12-7(10)11-8(13-9)14-5-3-2-4-6-14/h2-6H2,1H3,(H2,10,11,12,13)

SMILES: CSc1nc(=N)nc([nH]1)N1CCCCC1

Synonyms:

• 4-(Methylsulfanyl)-6-Piperidin-1-Yl-1,3,5-Triazin-2-Amine

4-(Methylthio)-6-(piperidin-1-yl)-1,3,5-triazin-2-amine

CAS: 101071-66-3

Formula: C₉H₁₅N₅S

Molecular weight: 225.3139

Ref: IN-DA0003N7

4-(methylthio)-6-piperidino-1,3,5-triazin-2-amine

CAS: 101071-66-3

4-(methylthio)-6-piperidino-1,3,5-triazin-2-amine

Purity: ≥95%

Ref: 54-OR27318