CymitQuimica logo

CAS 101071-97-0

:

8-Bromo-3,7-dihydro-3-methyl-7-propyl-1H-purine-2,6-dione

Description:
8-Bromo-3,7-dihydro-3-methyl-7-propyl-1H-purine-2,6-dione, with the CAS number 101071-97-0, is a purine derivative characterized by its bromine substitution and specific alkyl groups. This compound features a purine core, which is a bicyclic structure composed of a fused imidazole and pyrimidine ring. The presence of the bromine atom at the 8-position and the methyl and propyl groups at the 3 and 7 positions, respectively, contribute to its unique chemical properties and potential biological activity. It is typically a solid at room temperature and may exhibit solubility in organic solvents. The compound is of interest in medicinal chemistry, particularly for its potential roles in pharmacology and biochemistry, as purine derivatives are often involved in various biological processes, including nucleic acid metabolism and signaling pathways. Its specific interactions and reactivity can be influenced by the functional groups present, making it a subject of study for drug development and therapeutic applications.
Formula:C9H11BrN4O2
InChI:InChI=1S/C9H11BrN4O2/c1-3-4-14-5-6(11-8(14)10)13(2)9(16)12-7(5)15/h3-4H2,1-2H3,(H,12,15,16)
InChI key:InChIKey=VGFFHBADFGHZQK-UHFFFAOYSA-N
SMILES:C(CC)N1C2=C(N=C1Br)N(C)C(=O)NC2=O
Synonyms:
  • 1H-Purine-2,6-dione, 8-bromo-3,7-dihydro-3-methyl-7-propyl-
  • 8-Bromo-3,7-dihydro-3-methyl-7-propyl-1H-purine-2,6-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.