CymitQuimica logo

CAS 101071-99-2

:

8-Bromo-3,7-dihydro-3-methyl-7-(2-phenylethyl)-1H-purine-2,6-dione

Description:
8-Bromo-3,7-dihydro-3-methyl-7-(2-phenylethyl)-1H-purine-2,6-dione, with the CAS number 101071-99-2, is a purine derivative characterized by its complex structure, which includes a bromine atom and a phenylethyl side chain. This compound typically exhibits properties associated with purines, such as potential biological activity, particularly in the context of nucleic acid interactions. The presence of the bromine substituent may influence its reactivity and solubility, while the methyl and phenylethyl groups can affect its pharmacological properties. It is often studied for its potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting various biological pathways. The compound's stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C14H13BrN4O2
InChI:InChI=1S/C14H13BrN4O2/c1-18-11-10(12(20)17-14(18)21)19(13(15)16-11)8-7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,17,20,21)
InChI key:InChIKey=LPIKUTPXASWEHJ-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=C1)N2C3=C(N(C)C(=O)NC3=O)N=C2Br
Synonyms:
  • 1H-Purine-2,6-dione, 8-bromo-3,7-dihydro-3-methyl-7-(2-phenylethyl)-
  • 8-Bromo-3,7-dihydro-3-methyl-7-(2-phenylethyl)-1H-purine-2,6-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.