CymitQuimica logo

CAS 101074-13-9

:

1,3,5,7-tetramethyl-1,3,5,7-tetrazocane-2,6-dione

Description:
1,3,5,7-Tetramethyl-1,3,5,7-tetrazocane-2,6-dione, with CAS number 101074-13-9, is a chemical compound characterized by its unique tetrazocane ring structure, which incorporates nitrogen atoms in a cyclic arrangement. This compound features four methyl groups attached to the nitrogen atoms, contributing to its stability and influencing its reactivity. The presence of the dione functional groups indicates that it contains two carbonyl (C=O) groups, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carbonyl groups. Its potential applications may include use in organic synthesis, materials science, or as a precursor in the development of more complex chemical entities. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C8H16N4O2
InChI:InChI=1/C8H16N4O2/c1-9-5-10(2)8(14)12(4)6-11(3)7(9)13/h5-6H2,1-4H3
SMILES:CN1CN(C)C(=O)N(C)CN(C)C1=O
Synonyms:
  • 1,3,5,7-Tetramethyltetrahydro-2,6(1H,3H)-1,3,5,7-tetrazocine-2,6-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.