CymitQuimica logo

CAS 101079-84-9

:

4-Chloro-1-(chloromethyl)-2-methoxybenzene

Description:
4-Chloro-1-(chloromethyl)-2-methoxybenzene, with the CAS number 101079-84-9, is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3) and two chlorine substituents. This compound features a chloromethyl group (-CH2Cl) attached to the benzene ring, contributing to its reactivity. The presence of chlorine atoms enhances its electrophilic properties, making it a potential intermediate in various chemical syntheses, particularly in the production of pharmaceuticals and agrochemicals. The methoxy group can influence the compound's solubility and reactivity, often making it more lipophilic. In terms of physical properties, it is typically a colorless to pale yellow liquid or solid, depending on the specific conditions. Its applications may include use in organic synthesis, where it can participate in nucleophilic substitution reactions or serve as a building block for more complex molecules. Safety data should be consulted, as halogenated compounds can pose health and environmental risks.
Formula:C8H8Cl2O
InChI:InChI=1S/C8H8Cl2O/c1-11-8-4-7(10)3-2-6(8)5-9/h2-4H,5H2,1H3
InChI key:InChIKey=DZNWZPDQZJANKH-UHFFFAOYSA-N
SMILES:C(Cl)C1=C(OC)C=C(Cl)C=C1
Synonyms:
  • 4-Chloro-2-methoxybenzyl chloride
  • 4-Chloro-1-(chloromethyl)-2-methoxybenzene
  • Anisole, 5-chloro-2-(chloromethyl)-
  • Benzene, 4-chloro-1-(chloromethyl)-2-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.