CAS 101080-15-3

2-Thiazolamine, 5-(1-methylethyl)-

Description:

2-Thiazolamine, 5-(1-methylethyl)-, with the CAS number 101080-15-3, is an organic compound characterized by its thiazole ring structure, which incorporates both sulfur and nitrogen atoms. This compound features an amine functional group, contributing to its reactivity and potential applications in various chemical reactions. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. Typically, thiazolamines exhibit biological activity, making them of interest in pharmaceutical research, particularly for their potential antimicrobial or antifungal properties. The compound's stability, reactivity, and specific interactions depend on its molecular structure, which can be influenced by environmental factors such as pH and temperature. As with many thiazole derivatives, it may also participate in coordination chemistry, forming complexes with metal ions. Overall, 2-Thiazolamine, 5-(1-methylethyl)- represents a versatile structure with potential applications in medicinal chemistry and materials science.

Formula: C₆H₁₀N₂S

InChI: InChI=1/C6H10N2S/c1-4(2)5-3-8-6(7)9-5/h3-4H,1-2H3,(H2,7,8)

SMILES: CC(C)c1c[nH]c(=N)s1

Synonyms:

• 2-Amino-5-isopropy-thiazole
• 5-(Propan-2-Yl)-1,3-Thiazol-2-Amine
• 5-isopropylthiazol-2-amine

2-Amino-5-isopropylthiazole

CAS: 101080-15-3

Formula: C₆H₁₀N₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 142.2220

Ref: IN-DA0003OR

5-Isopropylthiazol-2-Amine

CAS: 101080-15-3

5-Isopropylthiazol-2-Amine

Purity: 99%

Molecular weight: 142.22g/mol

Ref: 54-OR1011894

5-Isopropylthiazol-2-amine

CAS: 101080-15-3

Formula: C₆H₁₀N₂S

Purity: 95%

Color and Shape: Liquid

Molecular weight: 142.22

Ref: 10-F329510