CAS 101080-64-2

2-[(3,4-Dichlorophenyl)sulfonyl]ethanol

Description:

2-[(3,4-Dichlorophenyl)sulfonyl]ethanol, with the CAS number 101080-64-2, is an organic compound characterized by the presence of a sulfonyl group attached to a dichlorophenyl moiety and an ethanol unit. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the hydroxyl group in the ethanol part of its structure. The dichlorophenyl group contributes to its chemical reactivity and may influence its biological activity, making it of interest in pharmaceutical research. The sulfonyl group can enhance the compound's ability to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the presence of chlorine atoms can affect the compound's electronic properties and stability. Overall, 2-[(3,4-Dichlorophenyl)sulfonyl]ethanol is notable for its potential applications in medicinal chemistry and as a building block in the synthesis of more complex molecules.

Formula: C₈H₈Cl₂O₃S

InChI: InChI=1S/C8H8Cl2O3S/c9-7-2-1-6(5-8(7)10)14(12,13)4-3-11/h1-2,5,11H,3-4H2

InChI key: InChIKey=BUGOSLZRRRMSSH-UHFFFAOYSA-N

SMILES: S(CCO)(=O)(=O)C1=CC(Cl)=C(Cl)C=C1

Synonyms:

• 2-(3,4-Dichlorobenzenesulfonyl)ethan-1-ol
• Ethanol, 2-[(3,4-dichlorophenyl)sulfonyl]-
• 2-[(3,4-Dichlorophenyl)sulfonyl]ethanol

3,4-Dichlorophenylsulfonylethanol

CAS: 101080-64-2

Formula: C₈H₈Cl₂O₃S

Purity: 98.0%

Color and Shape: Solid, No data available.

Molecular weight: 255.11

Ref: 10-F019412