CAS 101080-67-5
:2-(Methylamino)octanoic acid
Description:
2-(Methylamino)octanoic acid, also known by its CAS number 101080-67-5, is an amino acid derivative characterized by the presence of a methylamino group attached to an octanoic acid backbone. This compound features a long hydrophobic carbon chain, which contributes to its lipophilicity, while the amino group introduces basic properties, allowing it to participate in various biochemical interactions. It is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid and amino functional groups. The compound may exhibit zwitterionic behavior, depending on the pH of the solution, which can influence its solubility and reactivity. 2-(Methylamino)octanoic acid is of interest in biochemical research and potential applications in pharmaceuticals, particularly in the context of metabolic pathways and as a building block for peptide synthesis. Its specific interactions and biological activities would depend on its structural conformation and the surrounding environment.
Formula:C9H19NO2
InChI:InChI=1S/C9H19NO2/c1-3-4-5-6-7-8(10-2)9(11)12/h8,10H,3-7H2,1-2H3,(H,11,12)
InChI key:InChIKey=JXOCWFZISGFFJB-UHFFFAOYSA-N
SMILES:C(CCCCCC)(C(O)=O)NC
Synonyms:- 2-(Methylamino)octanoic acid
- Octanoic acid, 2-(methylamino)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-(Methylamino)octanoic Acid
CAS:Controlled Product<p>Applications 2-(methylamino)octanoic acid (cas# 101080-67-5) is a useful research chemical.<br></p>Formula:C9H19NO2Color and Shape:NeatMolecular weight:173.252-(Methylamino)octanoic acid
CAS:2-(Methylamino)octanoic acid is a ring-opening lactam molecule. It is an anionic polymerization and can be used to make linear polymers. 2-(Methylamino)octanoic acid has been shown to inhibit the arachidonic acid cascade, which is a pathway that leads to inflammation and pain. This drug also inhibits estrogen production in breast cancer cells and has been shown to reduce the size of tumors in mice. 2-(Methylamino)octanoic acid also has anti-inflammatory properties and is being studied as a potential treatment for rheumatoid arthritis.Formula:C9H19NO2Purity:Min. 95%Molecular weight:173.25 g/mol

