CymitQuimica logo

CAS 1010836-59-5

:

Tetrahydro-4-[[(methylsulfonyl)oxy]methyl]-2H-pyran-4-carbonitrile

Description:
Tetrahydro-4-[[(methylsulfonyl)oxy]methyl]-2H-pyran-4-carbonitrile is a chemical compound characterized by its unique structural features, including a tetrahydropyran ring and a carbonitrile functional group. The presence of a methylsulfonyl group contributes to its potential reactivity and solubility properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar organic solvents, which may enhance its utility in various chemical reactions and applications. The carbonitrile group indicates potential for nucleophilic reactivity, while the methylsulfonyl moiety may impart specific electronic properties. This compound may be of interest in medicinal chemistry and synthetic organic chemistry due to its potential biological activity and utility as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as compounds with similar structures can exhibit varying degrees of toxicity and environmental impact.
Formula:C8H13NO4S
InChI:InChI=1S/C8H13NO4S/c1-14(10,11)13-7-8(6-9)2-4-12-5-3-8/h2-5,7H2,1H3
InChI key:InChIKey=VUOQYFNNLVVVHL-UHFFFAOYSA-N
SMILES:C(OS(C)(=O)=O)C1(C#N)CCOCC1
Synonyms:
  • 2H-Pyran-4-carbonitrile, tetrahydro-4-[[(methylsulfonyl)oxy]methyl]-
  • (4-Cyanooxan-4-yl)methyl methanesulfonate
  • Tetrahydro-4-[[(methylsulfonyl)oxy]methyl]-2H-pyran-4-carbonitrile
  • (4-Cyanotetrahydropyran-4-yl)methyl methanesulfonate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.