CAS 101084-20-2

3-Amino-5-bromopyridin-4-ol

Description:

3-Amino-5-bromopyridin-4-ol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an amino group (-NH2) and a hydroxyl group (-OH) attached to the pyridine ring, contributing to its reactivity and potential applications in medicinal chemistry. The presence of a bromine atom at the 5-position of the pyridine ring enhances its electrophilic properties, making it a useful intermediate in various chemical syntheses. The compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the hydroxyl group. Its structure allows for hydrogen bonding, which can influence its physical properties and interactions with biological targets. 3-Amino-5-bromopyridin-4-ol may be utilized in the development of pharmaceuticals, agrochemicals, or as a building block in organic synthesis, highlighting its significance in both research and industrial applications.

Formula: C₅H₅BrN₂O

InChI: InChI=1S/C5H5BrN2O/c6-3-1-8-2-4(7)5(3)9/h1-2H,7H2,(H,8,9)

SMILES: c1c(c(=O)c(c[nH]1)N)Br

Synonyms:

• 4-Pyridinol, 3-amino-5-bromo-
• 3-Amino-5-Bromo-Pyridin-4-Ol

4-Pyridinol, 3-amino-5-bromo-

CAS: 101084-20-2

Formula: C₅H₅BrN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 189.0100

Ref: IN-DA0003PG

3-Amino-5-Bromopyridin-4-Ol

CAS: 101084-20-2

3-Amino-5-Bromopyridin-4-Ol

Purity: 97%

Molecular weight: 189.01g/mol

Ref: 54-OR1030126

3-Amino-5-bromopyridin-4-ol

CAS: 101084-20-2

Formula: C₅H₅BrN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 189.012

Ref: 10-F210058