CymitQuimica logo

CAS 101084-82-6

:

4-Bromo-2-chloro-1-(methylthio)benzene

Description:
4-Bromo-2-chloro-1-(methylthio)benzene, with the CAS number 101084-82-6, is an organic compound characterized by the presence of a bromine atom, a chlorine atom, and a methylthio group attached to a benzene ring. This compound belongs to the class of halogenated aromatic hydrocarbons, which are known for their diverse applications in chemical synthesis and as intermediates in the production of pharmaceuticals and agrochemicals. The presence of both bromine and chlorine atoms contributes to its reactivity, making it a potential candidate for various substitution reactions. The methylthio group enhances its solubility in organic solvents and may influence its biological activity. Additionally, the compound's structure suggests potential uses in materials science and as a building block in organic synthesis. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 4-Bromo-2-chloro-1-(methylthio)benzene is a significant compound in organic chemistry with various potential applications.
Formula:C7H6BrClS
InChI:InChI=1S/C7H6BrClS/c1-10-7-3-2-5(8)4-6(7)9/h2-4H,1H3
InChI key:InChIKey=CNLWPJFTHPGRAM-UHFFFAOYSA-N
SMILES:S(C)C1=C(Cl)C=C(Br)C=C1
Synonyms:
  • 4-Bromo-2-chloro-1-(methylthio)benzene
  • Sulfide, 4-bromo-2-chlorophenyl methyl
  • 4-Bromo-2-chloro-1-(methylsulfanyl)benzene
  • Benzene, 4-bromo-2-chloro-1-(methylthio)-
  • (4-Bromo-2-chlorophenyl)(methyl)sulfane
Found 4 products.