
CAS 101085-21-6
:3-(4-Bromophenyl)-2-cyano-2-propenamide
Description:
3-(4-Bromophenyl)-2-cyano-2-propenamide, with the CAS number 101085-21-6, is an organic compound characterized by its unique structural features. It contains a propenamide functional group, which is a derivative of acrylic acid, and is substituted with a bromophenyl group and a cyano group. The presence of the bromine atom enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The cyano group contributes to the compound's polarity and can participate in various chemical reactions, such as nucleophilic additions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be essential for understanding its behavior in different environments and its potential uses in various chemical applications.
Formula:C10H7BrN2O
InChI:InChI=1S/C10H7BrN2O/c11-9-3-1-7(2-4-9)5-8(6-12)10(13)14/h1-5H,(H2,13,14)
InChI key:InChIKey=JTTTWTYPKBLSRW-UHFFFAOYSA-N
SMILES:C(=C(C(N)=O)C#N)C1=CC=C(Br)C=C1
Synonyms:- 3-(4-Bromophenyl)-2-cyano-2-propenamide
- Cinnamamide, p-bromo-α-cyano-
- 2-Propenamide, 3-(4-bromophenyl)-2-cyano-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
