CAS 101093-37-2
:trans-4-stilbenemethanol
Description:
Trans-4-stilbenemethanol, identified by its CAS number 101093-37-2, is an organic compound characterized by its structure, which features a stilbene backbone with a hydroxymethyl group attached to one of the phenyl rings. This compound is typically a white to off-white solid at room temperature and is known for its potential applications in various fields, including pharmaceuticals and materials science. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many organic compounds with hydrophobic aromatic structures. The presence of the hydroxymethyl group contributes to its reactivity, allowing for further chemical modifications. Additionally, trans-4-stilbenemethanol may exhibit interesting optical properties due to its conjugated system, making it a subject of interest in studies related to fluorescence and photochemistry. Its stability under standard conditions and its ability to participate in various chemical reactions make it a valuable compound for research and industrial applications.
Formula:C15H14O
InChI:InChI=1/C15H14O/c16-12-15-10-8-14(9-11-15)7-6-13-4-2-1-3-5-13/h1-11,16H,12H2
SMILES:c1ccc(cc1)C=Cc1ccc(cc1)CO
Synonyms:- {4-[(E)-2-phenylethenyl]phenyl}methanol
- [4-(2-Phenylethenyl)Phenyl]Methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
