CAS 1011-24-1

2-methoxyquinazolin-4(1H)-one

Description:

2-Methoxyquinazolin-4(1H)-one is a heterocyclic organic compound characterized by its quinazolinone structure, which features a fused benzene and pyrimidine ring system. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but has limited solubility in water. The presence of the methoxy group at the second position of the quinazolinone ring influences its chemical reactivity and biological activity. 2-Methoxyquinazolin-4(1H)-one has garnered interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and anticancer activities. Its molecular structure allows for various interactions with biological targets, making it a subject of research in drug development. Additionally, the compound can undergo various chemical reactions, such as substitution and oxidation, which can be exploited for further synthetic applications. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity and reactivity.

Formula: C₉H₈N₂O₂

InChI: InChI=1/C9H8N2O2/c1-13-9-10-7-5-3-2-4-6(7)8(12)11-9/h2-5H,1H3,(H,10,11,12)

SMILES: COc1nc2ccccc2c(n1)O

Synonyms:

• 2-Methoxyquinazolin-4-ol
• 4-Quinazolinol, 2-Methoxy-

4(3H)-Quinazolinone, 2-methoxy-

CAS: 1011-24-1

Formula: C₉H₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 176.1720

Ref: IN-DA0003QZ

2-Methoxyquinazolin-4-ol

CAS: 1011-24-1

2-Methoxyquinazolin-4-ol

Purity: 98%

Molecular weight: 176.17g/mol

Ref: 54-OR75381

2-methoxy-1,4-dihydroquinazolin-4-one

CAS: 1011-24-1

Purity: 98%

Molecular weight: 176.1750031

Ref: 10-F765302

2-Methoxyquinazolin-4-ol

CAS: 1011-24-1

Versatile small molecule scaffold

Formula: C₉H₈N₂O₂

Purity: Min. 95%

Molecular weight: 176.17 g/mol

Ref: 3D-BAA01124