
CAS 1011-95-6
:Diphenylstannane
Description:
Diphenylstannane, with the CAS number 1011-95-6, is an organotin compound characterized by the presence of two phenyl groups attached to a tin atom. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. Diphenylstannane is known for its relatively low toxicity compared to other organotin compounds, although it still poses environmental and health risks, particularly in aquatic systems. It exhibits moderate solubility in organic solvents and is often used as a reagent in organic synthesis and as a stabilizer in polymer formulations. The compound can undergo various chemical reactions, including oxidation and hydrolysis, which can lead to the formation of other tin-containing species. Due to its organotin nature, diphenylstannane can also exhibit biocidal properties, making it of interest in agricultural and industrial applications. However, regulatory scrutiny surrounding organotin compounds has increased due to concerns over their environmental persistence and potential endocrine-disrupting effects.
Formula:C12H12Sn
InChI:InChI=1S/2C6H5.Sn/c2*1-2-4-6-5-3-1;/h2*1-5H;
InChI key:InChIKey=KUCPUSUXIGWHFB-UHFFFAOYSA-N
SMILES:[SnH2](C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- Diphenyltin dihydride
- Diphenylstannane
- DPT
- Stannane, diphenyl-
- Tin, dihydrodiphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
