CymitQuimica logo

CAS 101130-32-9

:

4-CHLORO-2-[2-PHENYLVINYL]-5,6,7,8-TETRAHYDRO[1]BENZOTHIENO[2,3-D]PYRIMIDINE

Description:
4-Chloro-2-[2-phenylvinyl]-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine is a complex organic compound characterized by its unique bicyclic structure, which incorporates both a benzothieno and pyrimidine moiety. This compound features a chloro substituent and a phenylvinyl group, contributing to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the chloro group can influence its electronic properties, potentially affecting its interactions in biological systems. This compound may be of interest in medicinal chemistry due to its structural features, which could impart specific pharmacological properties. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. As with many organic compounds, safety precautions should be observed when handling, as it may pose health risks or environmental hazards.
Formula:C18H15ClN2S
InChI:InChI=1/C18H15ClN2S/c19-17-16-13-8-4-5-9-14(13)22-18(16)21-15(20-17)11-10-12-6-2-1-3-7-12/h1-3,6-7,10-11H,4-5,8-9H2/b11-10+
Synonyms:
  • 4-chloro-2-[(E)-2-phenylvinyl]-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine
  • 4-chloro-2-[(E)-2-phenylethenyl]-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.