CAS 1011301-29-3: Benzamide, N-[[[4-[[5-(dimethylamino)-1-oxopentyl]amino]phenyl]amino]thioxomethyl]-4-(1,1-dimethylethyl)-, hydrochloride (1:1)

Description:Benzamide, N-[[[4-[[5-(dimethylamino)-1-oxopentyl]amino]phenyl]amino]thioxomethyl]-4-(1,1-dimethylethyl)-, hydrochloride (1:1) is a complex organic compound characterized by its structural components, which include a benzamide core and various functional groups that contribute to its chemical properties. The presence of a thioxomethyl group and a dimethylamino moiety suggests potential biological activity, possibly influencing its solubility and reactivity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit properties such as moderate to high melting point, stability under standard conditions, and potential interactions with biological targets, making it of interest in medicinal chemistry. Its specific applications would depend on further studies, including its pharmacokinetics and pharmacodynamics. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with complex structures and potential biological activity.

Formula:C₂₅H₃₄N₄O₂S.ClH

InChI:InChI=1S/C25H34N4O2S.ClH/c1-25(2,3)19-11-9-18(10-12-19)23(31)28-24(32)27-21-15-13-20(14-16-21)26-22(30)8-6-7-17-29(4)5;/h9-16H,6-8,17H2,1-5H3,(H,26,30)(H2,27,28,31,32);1H

InChI key:InChIKey=UBNCTIDXQDCEPI-UHFFFAOYSA-N

SMILES:Cl.O=C(NC(=S)NC1=CC=C(C=C1)NC(=O)CCCCN(C)C)C2=CC=C(C=C2)C(C)(C)C

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Tenovin-6 Hydrochloride REF: TM-T8480CAS: 1011301-29-3	100%	39.00 €~376.00 €	Mon 10 Mar 25
	Tenovin-6 Hydrochloride REF: 3D-LQB30129CAS: 1011301-29-3	Min. 95%	To inquire	Mon 14 Apr 25