CAS 1011396-63-6

6-Cyclopropyl-4-(methoxycarbonyl)-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

Description:

6-Cyclopropyl-4-(methoxycarbonyl)-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid is a chemical compound characterized by its unique pyrazolo-pyridine structure, which incorporates a cyclopropyl group and a methoxycarbonyl moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural features. The presence of the carboxylic acid functional group suggests it may exhibit acidic properties, influencing its solubility and reactivity in various solvents. Additionally, the methoxycarbonyl group can enhance lipophilicity, potentially affecting its pharmacokinetic profile. The compound's molecular structure may allow for interactions with biological targets, making it of interest in medicinal chemistry. Its CAS number, 1011396-63-6, facilitates its identification in chemical databases, aiding in research and development efforts. Overall, this compound represents a class of heterocycles that may have applications in drug discovery and development, although specific biological activities and applications would require further investigation.

Formula: C₁₄H₁₅N₃O₄

InChI: InChI=1S/C14H15N3O4/c1-7-12-9(14(20)21-2)5-10(8-3-4-8)15-13(12)17(16-7)6-11(18)19/h5,8H,3-4,6H2,1-2H3,(H,18,19)

InChI key: InChIKey=ACYGEGIPAJPBGM-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(N(CC(O)=O)N=C2C)=NC(=C1)C3CC3

Synonyms:

• 6-Cyclopropyl-4-(methoxycarbonyl)-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid
• 1H-Pyrazolo[3,4-b]pyridine-1-acetic acid, 6-cyclopropyl-4-(methoxycarbonyl)-3-methyl-

2-[6-Cyclopropyl-4-(methoxycarbonyl)-3-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl]acetic acid

CAS: 1011396-63-6

Versatile small molecule scaffold

Formula: C₁₄H₁₅N₃O₄

Purity: Min. 95%

Molecular weight: 289.29 g/mol

Ref: 3D-LQB39663