CAS 1011396-75-0
:3,6-Dicyclopropyl-1-(4-methoxyphenyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid
Description:
3,6-Dicyclopropyl-1-(4-methoxyphenyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core, two cyclopropyl groups, and a methoxyphenyl substituent. This compound is notable for its potential biological activity, particularly in medicinal chemistry, where it may exhibit properties relevant to pharmacology. The presence of the carboxylic acid functional group suggests it may participate in hydrogen bonding and could influence its solubility and reactivity. The methoxy group can enhance lipophilicity, potentially affecting the compound's bioavailability. Additionally, the cyclopropyl groups may contribute to the compound's conformational rigidity, which can be significant in drug design. Overall, this compound's unique structural features may lead to interesting interactions with biological targets, making it a subject of interest in research related to therapeutic applications. However, specific data regarding its physical properties, reactivity, and biological activity would require further investigation and experimental validation.
Formula:C20H19N3O3
InChI:InChI=1S/C20H19N3O3/c1-26-14-8-6-13(7-9-14)23-19-17(18(22-23)12-4-5-12)15(20(24)25)10-16(21-19)11-2-3-11/h6-12H,2-5H2,1H3,(H,24,25)
InChI key:InChIKey=OEBVSQIMIYWZAJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(N(N=C2C3CC3)C4=CC=C(OC)C=C4)=NC(=C1)C5CC5
Synonyms:- 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 3,6-dicyclopropyl-1-(4-methoxyphenyl)-
- 3,6-Dicyclopropyl-1-(4-methoxyphenyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.