CAS 1011396-81-8

Methyl 6-cyclopropyl-1-(4-fluorophenyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylate

Description:

Methyl 6-cyclopropyl-1-(4-fluorophenyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyridine core, a cyclopropyl group, and a fluorophenyl substituent. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the fluorine atom may enhance lipophilicity and influence the compound's interaction with biological targets. The methyl ester functional group suggests that it may undergo hydrolysis to yield the corresponding carboxylic acid, which can further participate in various chemical reactions. Additionally, the compound's unique structural features may contribute to its solubility and stability in different solvents. Overall, Methyl 6-cyclopropyl-1-(4-fluorophenyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylate represents a class of compounds that could have applications in pharmaceuticals, particularly in the development of new therapeutic agents.

Formula: C₁₇H₁₄FN₃O₂

InChI: InChI=1S/C17H14FN3O2/c1-23-17(22)13-8-15(10-2-3-10)20-16-14(13)9-19-21(16)12-6-4-11(18)5-7-12/h4-10H,2-3H2,1H3

InChI key: InChIKey=XRCKQYGXMQVIRK-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(N(N=C2)C3=CC=C(F)C=C3)=NC(=C1)C4CC4

Synonyms:

• Methyl 6-cyclopropyl-1-(4-fluorophenyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylate
• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 6-cyclopropyl-1-(4-fluorophenyl)-, methyl ester