
CAS 1011396-96-5
:Methyl 3-methyl-6-phenylisoxazolo[5,4-b]pyridine-4-carboxylate
Description:
Methyl 3-methyl-6-phenylisoxazolo[5,4-b]pyridine-4-carboxylate, identified by its CAS number 1011396-96-5, is a chemical compound that features a complex bicyclic structure incorporating both isoxazole and pyridine moieties. This compound typically exhibits characteristics common to heterocyclic compounds, such as potential biological activity and varied solubility depending on the solvent used. The presence of the methyl and phenyl groups suggests that it may have hydrophobic properties, which can influence its interactions in biological systems. Additionally, the carboxylate functional group can participate in various chemical reactions, including esterification and nucleophilic attacks. Methyl 3-methyl-6-phenylisoxazolo[5,4-b]pyridine-4-carboxylate may be of interest in medicinal chemistry due to its structural features, which could contribute to its pharmacological properties. However, specific data regarding its reactivity, stability, and biological activity would require further investigation through experimental studies.
Formula:C15H12N2O3
InChI:InChI=1S/C15H12N2O3/c1-9-13-11(15(18)19-2)8-12(16-14(13)20-17-9)10-6-4-3-5-7-10/h3-8H,1-2H3
InChI key:InChIKey=PTQYKWBDLQRPDH-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(=NC(=C1)C3=CC=CC=C3)ON=C2C
Synonyms:- Methyl 3-methyl-6-phenylisoxazolo[5,4-b]pyridine-4-carboxylate
- Isoxazolo[5,4-b]pyridine-4-carboxylic acid, 3-methyl-6-phenyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.