CAS 1011397-44-6

2H-1,2,6-Thiadiazine-3-carboxylic acid, 5-(4-methoxyphenyl)-, 1,1-dioxide

Description:

2H-1,2,6-Thiadiazine-3-carboxylic acid, 5-(4-methoxyphenyl)-, 1,1-dioxide, identified by its CAS number 1011397-44-6, is a heterocyclic compound featuring a thiadiazine ring, which is characterized by the presence of sulfur and nitrogen atoms in its structure. This compound typically exhibits properties associated with both acidic and aromatic functionalities due to the carboxylic acid group and the methoxy-substituted phenyl group. The presence of the 1,1-dioxide functional group indicates that it has two double-bonded oxygen atoms, which can influence its reactivity and stability. Such compounds often display biological activity, making them of interest in medicinal chemistry. The methoxy group can enhance lipophilicity, potentially affecting the compound's solubility and permeability. Overall, this substance may be explored for various applications, including pharmaceuticals, due to its unique structural features and potential biological properties. However, specific characteristics such as melting point, solubility, and reactivity would require empirical data for precise evaluation.

Formula: C₁₁H₁₀N₂O₅S

InChI: InChI=1S/C11H10N2O5S/c1-18-8-4-2-7(3-5-8)9-6-10(11(14)15)13-19(16,17)12-9/h2-6,12H,1H3,(H,14,15)

InChI key: InChIKey=XSVWPGRTTNOZEN-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(NS(=O)(=O)N1)C2=CC=C(OC)C=C2

Synonyms:

• 2H-1,2,6-Thiadiazine-3-carboxylic acid, 5-(4-methoxyphenyl)-, 1,1-dioxide
• 5-(4-Methoxyphenyl)-1,1-dioxo-2h-1lambda6,2,6-thiadiazine-3-carboxylic acid
• 5-(4-methoxyphenyl)-2H-1,2,6-thiadiazine-3-carboxylic acid 1,1-dioxide

5-(4-Methoxyphenyl)-2H-1,2,6-thiadiazine-3-carboxylic acid 1,1-dioxide

CAS: 1011397-44-6

Versatile small molecule scaffold

Formula: C₁₁H₁₀N₂O₅S

Purity: Min. 95%

Molecular weight: 282.27 g/mol

Ref: 3D-LQB39744