CAS 1011397-97-9

5-Chloro-N-[(1-methyl-1H-pyrrol-2-yl)methyl]-1H-indole-3-ethanamine

Description:

5-Chloro-N-[(1-methyl-1H-pyrrol-2-yl)methyl]-1H-indole-3-ethanamine, with the CAS number 1011397-97-9, is a chemical compound characterized by its complex structure, which includes an indole core, a chloro substituent, and a pyrrole moiety. This compound typically exhibits properties associated with both indole and amine functionalities, potentially influencing its reactivity and biological activity. The presence of the chloro group may enhance its lipophilicity, while the ethylamine side chain can contribute to its basicity and potential interactions with biological targets. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including effects on neurotransmitter systems. The specific stereochemistry and electronic properties of the substituents can significantly affect the compound's behavior in biological systems, making it a candidate for further research in drug development and therapeutic applications. As with many organic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity.

Formula: C₁₆H₁₈ClN₃

InChI: InChI=1S/C16H18ClN3/c1-20-8-2-3-14(20)11-18-7-6-12-10-19-16-5-4-13(17)9-15(12)16/h2-5,8-10,18-19H,6-7,11H2,1H3

InChI key: InChIKey=IMMSPAXSWBSOOZ-UHFFFAOYSA-N

SMILES: C(CNCC=1N(C)C=CC1)C=2C=3C(NC2)=CC=C(Cl)C3

Synonyms:

• 5-Chloro-N-[(1-methyl-1H-pyrrol-2-yl)methyl]-1H-indole-3-ethanamine
• 1H-Indole-3-ethanamine, 5-chloro-N-[(1-methyl-1H-pyrrol-2-yl)methyl]-

[2-(5-Chloro-1H-indol-3-yl)ethyl][(1-methyl-1H-pyrrol-2-yl)methyl]amine

CAS: 1011397-97-9

Versatile small molecule scaffold

Formula: C₁₆H₁₈ClN₃

Purity: Min. 95%

Molecular weight: 287.79 g/mol

Ref: 3D-LQB39797