CAS 1011398-29-0

1-(2-Fluorophenyl)-6-(2-thienyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

Description:

1-(2-Fluorophenyl)-6-(2-thienyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core fused with a thienyl group and a fluorophenyl substituent. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the fluorine atom in the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. The thienyl group adds to the compound's aromatic character and may also affect its interactions in biological systems. Such compounds are often investigated for their pharmacological properties, including potential roles as anti-inflammatory or anticancer agents. The specific arrangement of atoms and functional groups in this molecule can lead to unique chemical behaviors, making it of interest in medicinal chemistry and drug development. Its CAS number, 1011398-29-0, allows for precise identification in chemical databases and literature.

Formula: C₁₇H₁₀FN₃O₂S

InChI: InChI=1S/C17H10FN3O2S/c18-12-4-1-2-5-14(12)21-16-11(9-19-21)10(17(22)23)8-13(20-16)15-6-3-7-24-15/h1-9H,(H,22,23)

InChI key: InChIKey=RDWJCUHBJUSARG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(N(N=C2)C3=C(F)C=CC=C3)=NC(=C1)C4=CC=CS4

Synonyms:

• 1-(2-Fluorophenyl)-6-(2-thienyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid
• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 1-(2-fluorophenyl)-6-(2-thienyl)-

1-(2-Fluorophenyl)-6-(thiophen-2-yl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

CAS: 1011398-29-0

Versatile small molecule scaffold

Formula: C₁₇H₁₀FN₃O₂S

Purity: Min. 95%

Molecular weight: 339.3 g/mol

Ref: 3D-LQB39829