CAS 1011398-57-4

3-Methyl-6-phenyl-1-(phenylmethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

Description:

3-Methyl-6-phenyl-1-(phenylmethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyridine core. This compound features multiple aromatic rings, contributing to its potential for various interactions in biological systems. The presence of the carboxylic acid functional group suggests it may exhibit acidic properties, influencing its solubility and reactivity in different environments. The methyl and phenyl substituents enhance its lipophilicity, which can affect its pharmacokinetic properties if considered for medicinal applications. Additionally, the compound's unique structure may confer specific biological activities, making it of interest in pharmaceutical research. Its CAS number, 1011398-57-4, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential applications. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly in the realm of drug discovery and development.

Formula: C₂₁H₁₇N₃O₂

InChI: InChI=1S/C21H17N3O2/c1-14-19-17(21(25)26)12-18(16-10-6-3-7-11-16)22-20(19)24(23-14)13-15-8-4-2-5-9-15/h2-12H,13H2,1H3,(H,25,26)

InChI key: InChIKey=INGANDBCBKZWMG-UHFFFAOYSA-N

SMILES: C(N1C=2C(=C(C(O)=O)C=C(N2)C3=CC=CC=C3)C(C)=N1)C4=CC=CC=C4

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 3-methyl-6-phenyl-1-(phenylmethyl)-
• 3-Methyl-6-phenyl-1-(phenylmethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid