
CAS 10114-48-4
:4-Hydroxy-1-methyl-3-[2-(2-nitrophenyl)diazenyl]-2(1H)-quinolinone
Description:
4-Hydroxy-1-methyl-3-[2-(2-nitrophenyl)diazenyl]-2(1H)-quinolinone, with CAS number 10114-48-4, is an organic compound characterized by its complex structure, which includes a quinolinone core, a hydroxyl group, and a diazenyl moiety linked to a nitrophenyl group. This compound typically exhibits a yellow to orange color due to the presence of the nitrophenyl group, which can also influence its electronic properties and reactivity. It is known for its potential applications in dye chemistry and as a biological probe due to its ability to interact with various biological systems. The presence of the hydroxyl group contributes to its solubility in polar solvents, while the diazenyl group can participate in azo coupling reactions. Additionally, this compound may exhibit fluorescence properties, making it useful in analytical chemistry. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature, which are important considerations for its practical applications.
Formula:C16H12N4O4
InChI:InChI=1S/C16H12N4O4/c1-19-12-8-4-2-6-10(12)15(21)14(16(19)22)18-17-11-7-3-5-9-13(11)20(23)24/h2-9,21H,1H3
InChI key:InChIKey=BUJQHRIAICVCEJ-UHFFFAOYSA-N
SMILES:OC=1C=2C(N(C)C(=O)C1N=NC3=C(N(=O)=O)C=CC=C3)=CC=CC2
Synonyms:- Carbostyril, 4-hydroxy-1-methyl-3-[(o-nitrophenyl)azo]-
- 2(1H)-Quinolinone, 4-hydroxy-1-methyl-3-[(2-nitrophenyl)azo]-
- 4-Hydroxy-1-methyl-3-[2-(2-nitrophenyl)diazenyl]-2(1H)-quinolinone
- 2(1H)-Quinolinone, 4-hydroxy-1-methyl-3-[2-(2-nitrophenyl)diazenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2(1H)-Quinolinone, 4-hydroxy-1-methyl-3-[2-(2-nitrophenyl)diazenyl]-
CAS:Formula:C16H12N4O4Molecular weight:324.2909
