
CAS 10114-51-9
:Benzamide, N,N′-(9,10-dihydro-9,10-dioxo-1,8-anthracenediyl)bis-
Description:
Benzamide, N,N′-(9,10-dihydro-9,10-dioxo-1,8-anthracenediyl)bis- is an organic compound characterized by its structure, which features a benzamide moiety linked to a bis-anthracene derivative. This compound exhibits properties typical of both benzamides and polycyclic aromatic hydrocarbons. It is likely to be a solid at room temperature, with a relatively high melting point due to the presence of multiple aromatic rings that contribute to strong π-π stacking interactions. The presence of the dioxo groups suggests potential reactivity, particularly in redox reactions or as a ligand in coordination chemistry. Additionally, the compound may exhibit fluorescence due to the conjugated system of the anthracene units, making it of interest in materials science and organic electronics. Its solubility is expected to vary depending on the solvent polarity, with better solubility in organic solvents. Safety data should be consulted for handling, as compounds of this nature can pose health risks. Overall, this compound represents a fascinating intersection of organic chemistry and materials science.
Formula:C28H18N2O4
InChI:InChI=1S/C28H18N2O4/c31-25-19-13-7-15-21(29-27(33)17-9-3-1-4-10-17)23(19)26(32)24-20(25)14-8-16-22(24)30-28(34)18-11-5-2-6-12-18/h1-16H,(H,29,33)(H,30,34)
InChI key:InChIKey=MHIIKMFLEZGYPH-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=CC=C1)C2=C3C(C(=O)C=4C(C3=O)=C(NC(=O)C5=CC=CC=C5)C=CC4)=CC=C2
Synonyms:- Benzamide, N,N′-(9,10-dihydro-9,10-dioxo-1,8-anthracenediyl)bis-
- Anthraquinone, 1,8-dibenzamido-
- Benzamide, N,N′-1,8-anthraquinonylenebis-
- 1,8-Bis(benzamido)anthraquinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N,N'-(9,10-Dioxo-9,10-dihydroanthracene-1,8-diyl)dibenzamide
CAS:Formula:C28H18N2O4Molecular weight:446.4535
