CAS 1011426-50-8: 4-Thiazoleacetic acid, 2-(3-methoxyphenyl)-, sodium salt (1:1)

Description: 4-Thiazoleacetic acid, 2-(3-methoxyphenyl)-, sodium salt (1:1) is a chemical compound characterized by its thiazole and phenyl functional groups, which contribute to its biological activity and potential applications in pharmaceuticals. The presence of the sodium salt form indicates that it is a water-soluble compound, enhancing its bioavailability and making it suitable for various formulations. This compound typically exhibits properties such as moderate acidity due to the thiazoleacetic acid moiety, and it may participate in various chemical reactions due to the presence of the thiazole ring, which can engage in nucleophilic and electrophilic interactions. The methoxyphenyl group adds to its structural complexity and may influence its interaction with biological targets. Overall, this compound is of interest in medicinal chemistry, particularly for its potential therapeutic applications, although specific biological activities and mechanisms would require further investigation. Safety and handling considerations should be observed, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₁₂H₁₁NO₃S·Na

InChI: InChI=1S/C12H11NO3S.Na/c1-16-10-4-2-3-8(5-10)12-13-9(7-17-12)6-11(14)15;/h2-5,7H,6H2,1H3,(H,14,15);

InChI key: InChIKey=OWWYERBVYRXZDT-UHFFFAOYSA-N

SMILES: [Na].O=C(O)CC=1N=C(SC1)C=2C=CC=C(OC)C2

Synonyms:

• 4-Thiazoleacetic acid, 2-(3-methoxyphenyl)-, sodium salt (1:1)

Sodium 2-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]acetate

CAS: 1011426-50-8

Versatile small molecule scaffold

• Formula: C₁₂H₁₀NNaO₃S
• Purity: Min. 95%
• Molecular weight: 271.27 g/mol

Sodium 2-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]acetate

CAS: 1011426-50-8

• Purity: 95%
• Molecular weight: 271.2699890136719