CAS 10116-95-7

2,2,3,3,3-PENTAFLUORO-1-(P-TOLYL)PROPANE-1-ONE

Description:

2,2,3,3,3-Pentafluoro-1-(p-tolyl)propane-1-one, with the CAS number 10116-95-7, is a fluorinated organic compound characterized by its unique structure that includes a pentafluorinated propane moiety and a p-tolyl group. This compound is notable for its high degree of fluorination, which imparts significant chemical stability and alters its physical properties, such as boiling point and solubility. The presence of the p-tolyl group contributes to its aromatic characteristics, enhancing its reactivity in certain chemical reactions. Typically, fluorinated compounds exhibit low reactivity due to the strong C-F bonds, making them useful in various applications, including as intermediates in organic synthesis and in the development of pharmaceuticals. Additionally, the compound's unique properties may make it suitable for use in specialized materials or as a solvent in certain chemical processes. Safety data should be consulted for handling and storage, as fluorinated compounds can pose environmental and health risks.

Formula: C₁₀H₇F₅O

InChI: InChI=1/C10H7F5O/c1-6-2-4-7(5-3-6)8(16)9(11,12)10(13,14)15/h2-5H,1H3

SMILES: Cc1ccc(cc1)C(=O)C(C(F)(F)F)(F)F

Synonyms:

• 2,2,3,3,3-Pentafluoro-1-P-Tolyl-Propan-1-One
• 2,2,3,3,3-Pentafluoro-1-(4-Methylphenyl)Propan-1-One