CymitQuimica logo

CAS 1011711-58-2

:

4-Propoxy-1H-pyrrolo[2,3-b]pyridine

Description:
4-Propoxy-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyrrole rings. This compound features a propoxy group attached to the pyrrole nitrogen, influencing its solubility and reactivity. Typically, compounds of this class exhibit interesting biological activities, making them of interest in medicinal chemistry. The presence of the propoxy substituent can enhance lipophilicity, potentially affecting pharmacokinetic properties. Additionally, the compound may participate in various chemical reactions, such as electrophilic substitutions or nucleophilic attacks, due to the electron-rich nature of the pyrrole ring. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. As with many heterocycles, the stability and reactivity of 4-Propoxy-1H-pyrrolo[2,3-b]pyridine can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry, with implications for the development of new therapeutic agents.
Formula:C10H12N2O
InChI:InChI=1S/C10H12N2O/c1-2-7-13-9-4-6-12-10-8(9)3-5-11-10/h3-6H,2,7H2,1H3,(H,11,12)
InChI key:InChIKey=HSKZWIBUTZHXOR-UHFFFAOYSA-N
SMILES:O(CCC)C1=C2C(NC=C2)=NC=C1
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 4-propoxy-
  • 4-Propoxy-1H-pyrrolo[2,3-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.