CAS 1011736-08-5

4,5-Dihydro-1-nitroso-2-(phenylmethyl)-1H-imidazole

Description:

4,5-Dihydro-1-nitroso-2-(phenylmethyl)-1H-imidazole is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This specific compound features a nitroso group (-NO) and a phenylmethyl group (-CH2Ph) attached to the imidazole ring, contributing to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the nitroso group can impart distinct chemical properties, such as the ability to participate in various reactions, including nitration and oxidation processes. The compound's molecular structure suggests it may exhibit biological activity, making it of interest in pharmacological research. Additionally, its solubility and stability in different solvents can vary, influencing its practical applications. As with many nitrogen-containing heterocycles, it may also display interesting electronic properties, which can be leveraged in the development of new materials or catalysts. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₁₁N₃O

InChI: InChI=1S/C10H11N3O/c14-12-13-7-6-11-10(13)8-9-4-2-1-3-5-9/h1-5H,6-8H2

InChI key: InChIKey=CJRYRCFEHPNLLM-UHFFFAOYSA-N

SMILES: C(C=1N(N=O)CCN1)C2=CC=CC=C2

Synonyms:

• 4,5-Dihydro-1-nitroso-2-(phenylmethyl)-1H-imidazole
• 1H-Imidazole, 4,5-dihydro-1-nitroso-2-(phenylmethyl)-

N-Nitroso Tolazoline

CAS: 1011736-08-5

Formula: C₁₀H₁₁N₃O

Molecular weight: 189.22

Ref: 4Z-T-482002

N-Nitroso Tolazoline

Controlled Product

CAS: 1011736-08-5

Formula: C₁₀H₁₁N₃O

Color and Shape: Neat

Molecular weight: 189.214

Ref: TR-N418750