CymitQuimica logo

CAS 101184-10-5

:

5-Ethyl-2,3-dihydro-2-oxo-1H-imidazole-4-carboxylic acid

Description:
5-Ethyl-2,3-dihydro-2-oxo-1H-imidazole-4-carboxylic acid, with the CAS number 101184-10-5, is a heterocyclic organic compound characterized by its imidazole ring structure, which includes both a carboxylic acid and a ketone functional group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group, making it potentially useful in various chemical reactions and applications. Its structure suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity in different solvents. The ethyl substituent contributes to its hydrophobic character, which can affect its interaction with biological systems or other chemical entities. Additionally, compounds of this type may exhibit biological activity, making them of interest in pharmaceutical research. Overall, the unique combination of functional groups and structural features of 5-Ethyl-2,3-dihydro-2-oxo-1H-imidazole-4-carboxylic acid positions it as a compound of potential significance in both synthetic and medicinal chemistry.
Formula:C6H8N2O3
InChI:InChI=1S/C6H8N2O3/c1-2-3-4(5(9)10)8-6(11)7-3/h2H2,1H3,(H,9,10)(H2,7,8,11)
InChI key:InChIKey=BIIBLAGNYXUUEI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(CC)NC(=O)N1
Synonyms:
  • 5-Ethyl-2,3-dihydro-2-oxo-1H-imidazole-4-carboxylic acid
  • 1H-Imidazole-4-carboxylic acid, 5-ethyl-2,3-dihydro-2-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.