CAS 101187-39-7
:1,11-DIAZIDO-3,6,9-TRIOXAUNDECANE
Description:
1,11-Diazido-3,6,9-trioxaundecane is a chemical compound characterized by its unique structure, which includes a linear chain of carbon atoms interspersed with azide (N3) groups and ether (–O–) linkages. This compound features a total of 11 carbon atoms, with azide groups located at the terminal positions (1 and 11) and ether functionalities at the 3, 6, and 9 positions. The presence of azide groups imparts significant reactivity, particularly in click chemistry and potential applications in materials science and bioconjugation. The ether linkages contribute to the compound's solubility and stability in various solvents. Due to the presence of azide groups, 1,11-diazido-3,6,9-trioxaundecane may exhibit explosive properties under certain conditions, necessitating careful handling and storage. Its molecular structure suggests potential uses in the synthesis of polymers, pharmaceuticals, and as a precursor for further chemical modifications. Overall, this compound exemplifies the intersection of organic chemistry and materials science, with implications for innovative applications in various fields.
Formula:C8H16N6O3
InChI:InChI=1/C8H16N6O3/c9-13-11-1-3-15-5-7-17-8-6-16-4-2-12-14-10/h1-8H2
SMILES:C(COCCOCCOCCN=[N+]=[NH-])N=[N+]=[NH-]
Synonyms:- 2,2'-Oxybis[1-(2-Azidoethoxy)Ethane]
- Bis-PEG3-Azide
- Azido-PEG4-azide
- Ethane,1,1'-oxybis[2-(2-azidoethoxy)-
- Azido-PEG3-azide
- 1,1'-Oxybis[2-(2-azidoethoxy)ethane
- 1-Azido-2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethane
- Azido-PEG3-azido
- 1,11-DIAZIDO-3,6,9-TRIOXAUNDECANE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Ethane, 1,1'-oxybis[2-(2-azidoethoxy)-
CAS:Formula:C8H16N6O3Purity:98%Color and Shape:LiquidMolecular weight:244.25101-Azido-2-{2-[2-(2-azidoethoxy)ethoxy]ethoxy}ethane
CAS:Formula:C8H16N6O3Purity:95%Color and Shape:LiquidMolecular weight:244.255Azido-PEG3-azide
CAS:Azido-PEG3-azide is a PEG-based PROTAC linker that can be used in PROTAC synthesis.Formula:C8H16N6O3Purity:99.86%Color and Shape:SolidMolecular weight:244.25Azido-PEG3-azide
CAS:Controlled ProductApplications A useful linker for biomolecules.
Formula:C8H16N6O3Color and Shape:NeatMolecular weight:244.251,11-Diazido-3,6,9-trioxaundecane
CAS:1,11-Diazido-3,6,9-trioxaundecane is a clickable monomer that belongs to the class of solvents. It reacts with glycol to form a polymer. The nature of this compound is unknown. 1,11-Diazido-3,6,9-trioxaundecane has been shown to react with copper in an alkynyl copolymerization reaction. This compound is insoluble and can be used as a nanocarrier for drugs such as azide.
Formula:C8H16N6O3Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:244.25 g/mol





