CymitQuimica logo

CAS 101187-41-1

:

5,8,11-Trioxa-2,14-diazapentadecanoic acid, 15-(2,5,9-trimethyl-7-oxo-7H-furo[3,2-g][1]benzopyran-3-yl)-, 1,1-dimethylethyl ester

Description:
5,8,11-Trioxa-2,14-diazapentadecanoic acid, 15-(2,5,9-trimethyl-7-oxo-7H-furo[3,2-g][1]benzopyran-3-yl)-, 1,1-dimethylethyl ester, identified by CAS number 101187-41-1, is a complex organic compound characterized by its unique structural features, including multiple functional groups and a long carbon chain. The presence of both diazole and oxo groups suggests potential reactivity and biological activity, making it of interest in medicinal chemistry and material science. The ester functional group indicates that it can undergo hydrolysis, which may affect its stability and solubility in various solvents. The compound's furobenzopyran moiety may contribute to its photochemical properties, potentially allowing for applications in phototherapy or as a fluorescent marker. Additionally, the presence of multiple oxygen atoms in the structure may enhance its polarity, influencing its interactions with biological systems. Overall, this compound's intricate structure and functional diversity suggest potential utility in various fields, including pharmaceuticals and agrochemicals, although specific applications would require further investigation.
Formula:C28H40N2O8
InChI:InChI=1S/C28H40N2O8/c1-18-15-24(31)37-25-19(2)26-22(16-21(18)25)23(20(3)36-26)17-29-7-9-33-11-13-35-14-12-34-10-8-30-27(32)38-28(4,5)6/h15-16,29H,7-14,17H2,1-6H3,(H,30,32)
InChI key:InChIKey=XSPUHJHDYXCODE-UHFFFAOYSA-N
SMILES:C(NCCOCCOCCOCCNC(OC(C)(C)C)=O)C=1C=2C(=C(C)C3=C(C2)C(C)=CC(=O)O3)OC1C
Synonyms:
  • 5,8,11-Trioxa-2,14-diazapentadecanoic acid, 15-(2,5,9-trimethyl-7-oxo-7H-furo[3,2-g][1]benzopyran-3-yl)-, 1,1-dimethylethyl ester
  • 7H-Furo[3,2-g][1]benzopyran, 5,8,11-trioxa-2,14-diazapentadecanoic acid deriv.
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.