CAS 101189-47-3

2-(N-Pentyl-N'-guanidino)-4-(2-methylimidazol-4-yl)thiazole

Description:

2-(N-Pentyl-N'-guanidino)-4-(2-methylimidazol-4-yl)thiazole, with the CAS number 101189-47-3, is a chemical compound characterized by its complex structure, which includes a thiazole ring, a guanidine group, and a methylimidazole moiety. This compound typically exhibits properties associated with both thiazoles and imidazoles, such as potential biological activity and solubility in various solvents. The presence of the pentyl group suggests hydrophobic characteristics, while the guanidino group may contribute to its basicity and ability to form hydrogen bonds. Such structural features often indicate potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. The compound's unique arrangement of functional groups may also influence its reactivity and interaction with other molecules, making it of interest in medicinal chemistry and drug design. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other substances.

Formula: C₁₃H₂₀N₆S

InChI: InChI=1/C13H20N6S/c1-3-4-5-6-15-12(14)19-13-18-11(8-20-13)10-7-16-9(2)17-10/h7-8H,3-6H2,1-2H3,(H,16,17)(H3,14,15,18,19)

SMILES: CCCCCNC(=N)Nc1nc(cs1)c1cnc(C)[nH]1

Synonyms:

• Cp-66,948
• 1-[4-(2-methyl-1H-imidazol-5-yl)-1,3-thiazol-2-yl]-2-pentylguanidine

CP-66948

CAS: 101189-47-3

CP-66948

Purity: ≥98%

Molecular weight: 292.4g/mol

Ref: 54-BUP21599

CP-66948

CAS: 101189-47-3

CP-66948 is a potent histamine H2 receptor antagonist with inhibitory effect on gastric acid secretion and can be used to protect gastric and intestinal mucosa.

Formula: C₁₃H₂₀N₆S

Purity: 99.14%

Color and Shape: Solid

Molecular weight: 292.4

Ref: TM-T15005