CAS 101190-61-8
:naphthoquinomycin B
Description:
Naphthoquinomycin B is a naturally occurring compound that belongs to the class of naphthoquinones, which are characterized by their fused aromatic rings and a quinone functional group. This compound is notable for its biological activity, particularly its potential as an antibiotic and anticancer agent. Naphthoquinomycin B exhibits a complex structure that contributes to its reactivity and interaction with biological macromolecules, such as DNA and proteins. Its mechanism of action often involves the generation of reactive oxygen species, leading to oxidative stress in target cells. The compound has been studied for its effects on various cancer cell lines, showcasing its potential in therapeutic applications. Additionally, naphthoquinomycin B may possess antimicrobial properties, making it of interest in the development of new antibiotics. As with many natural products, its extraction and synthesis can be challenging, and ongoing research aims to explore its full pharmacological potential and optimize its use in medicine.
Formula:C40H47NO9S
InChI:InChI=1/C40H47NO9S/c1-21-12-10-8-9-11-13-31(45)41-34-38(49)28-19-26(6)37(48)33(32(28)39(50)40(34)51-7)36(47)25(5)18-24(4)35(46)23(3)15-17-27(42)16-14-22(2)30(44)20-29(21)43/h8-15,17-19,21,23-24,27,29,35,42-43,46,48H,16,20H2,1-7H3,(H,41,45)/b9-8-,12-10+,13-11+,17-15+,22-14+,25-18-
Synonyms:- 30-Dechloro-2-demethyl-30-(methylthio)naphthomycin A
- Naphthoquinomycin B
- 3,31-Methano-1H-4-benzazacyclononacosine-1,5,15,27,32(4H,12H,18H)-pentone, 13,14,19,22,23,24-hexahydro-13,19,23,28-tetrahydroxy-12,16,22,24,26,29-hexamethyl-2-(methylthio)-, (6Z,8Z,10E,12S,13S,16E,19S,20E,22S,23S,24S,25E)- (9CI)
- (6E,8Z,10E,16E,20E,25Z)-13,19,23,28-tetrahydroxy-12,16,22,24,26,29-hexamethyl-2-(methylsulfanyl)-13,14,19,22,23,24-hexahydro-1H-3,31-methano-4-benzazacyclononacosine-1,5,15,27,32(4H,12H,18H)-pentone
- Naphthomycin A, 30-dechloro-2-demethyl-30-(methylthio)-
- naphthoquinomycin B
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Naphthoquinomycin B
CAS:Naphthoquinomycin B is an antibiotic that exhibits activity against Gram-positive bacteria and fungi, and it inhibits the synthesis of fatty acids in Escherichia coli (E. coli).Formula:C40H47NO9SColor and Shape:SolidMolecular weight:717.867
