CAS 101190-62-9
:naphthoquinomycin A
Description:
Naphthoquinomycin A is a naturally occurring compound classified as an antibiotic, specifically belonging to the class of naphthoquinones. It is derived from certain species of bacteria, particularly those in the genus *Streptomyces*. This compound exhibits notable antibacterial and antitumor properties, making it of interest in pharmaceutical research. Naphthoquinomycin A is characterized by its complex polycyclic structure, which includes a naphthoquinone moiety, contributing to its biological activity. The compound's mechanism of action typically involves the inhibition of DNA synthesis, which is crucial for its effectiveness against rapidly dividing cells, such as those found in tumors or bacterial infections. Additionally, naphthoquinomycin A may exhibit cytotoxic effects, which can be leveraged in cancer treatment. Its solubility and stability in various solvents can vary, influencing its bioavailability and therapeutic potential. Ongoing studies aim to explore its full range of biological activities and potential applications in medicine, particularly in the development of new antimicrobial and anticancer agents.
Formula:C40H47NO10
InChI:InChI=1/C40H47NO10/c1-21-12-10-8-9-11-13-31(45)41-34-38(49)28-19-26(6)37(48)33(32(28)39(50)40(34)51-7)36(47)25(5)18-24(4)35(46)23(3)15-17-27(42)16-14-22(2)30(44)20-29(21)43/h8-15,17-19,21,23-24,27,29,35,42-43,46,48H,16,20H2,1-7H3,(H,41,45)/b9-8-,12-10+,13-11+,17-15+,22-14+,25-18-
Synonyms:- 30-Dechloro-2-demethyl-30-methoxynaphthomycin A
- Naphthoquinomycin A
- Naphthomycin A, 30-dechloro-2-demethyl-30-methoxy-
- naphthoquinomycin A
- (6E,8Z,10E,16E,20E,25Z)-13,19,23,28-tetrahydroxy-2-methoxy-12,16,22,24,26,29-hexamethyl-13,14,19,22,23,24-hexahydro-1H-3,31-methano-4-benzazacyclononacosine-1,5,15,27,32(4H,12H,18H)-pentone
- 3,31-Methano-1H-4-benzazacyclononacosine-1,5,15,27,32(4H,12H,18H)-pentone, 13,14,19,22,23,24-hexahydro-13,19,23,28-tetrahydroxy-2-methoxy-12,16,22,24,26,29-hexamethyl-, (6Z,8Z,10E,12S,13S,16E,19S,20E,22S,23S,24S,25E)- (9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Naphthoquinomycin A
CAS:Naphthoquinomycin A is an antibiotic that exhibits activity against Gram-positive bacteria and fungi, and also inhibits the synthesis of fatty acids in Escherichia coli.Formula:C40H47NO10Color and Shape:SolidMolecular weight:701.802
