CAS 1012-01-7
:1-Benzyl-3-pyrrolidinone hydrochloride
Description:
1-Benzyl-3-pyrrolidinone hydrochloride is a chemical compound characterized by its pyrrolidinone structure, which features a five-membered lactam ring. This compound is typically a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. It possesses a molecular formula that reflects the presence of both a benzyl group and a pyrrolidinone moiety, contributing to its unique chemical properties. The hydrochloride salt form indicates that it is a protonated version of the base compound, enhancing its stability and solubility. 1-Benzyl-3-pyrrolidinone hydrochloride is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological systems. Additionally, it may exhibit properties such as analgesic or psychoactive effects, although specific biological activities can vary. As with any chemical substance, proper handling and safety precautions are essential due to potential health risks associated with exposure.
Formula:C11H14ClNO
InChI:InChI=1/C11H13NO.ClH/c13-11-6-7-12(9-11)8-10-4-2-1-3-5-10;/h1-5H,6-9H2;1H
SMILES:c1ccc(cc1)CN1CCC(=O)C1.Cl
Synonyms:- 1-Benzylpyrrolidin-3-One,Hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
