CAS 1012-73-3
:1,1′-(1,4-Phenylene)bis[1,1,1-trimethylstannane]
Description:
1,1′-(1,4-Phenylene)bis[1,1,1-trimethylstannane], with the CAS number 1012-73-3, is an organotin compound characterized by its unique structure, which features a central 1,4-phenylene group bonded to two trimethylstannyl groups. This compound exhibits properties typical of organotin derivatives, including potential applications in materials science and organic synthesis. It is generally recognized for its stability and ability to act as a precursor in the synthesis of various organotin-based materials. The presence of tin in its structure contributes to its reactivity, particularly in coordination chemistry and catalysis. Additionally, the trimethyl groups enhance its solubility in organic solvents, making it suitable for various chemical reactions. However, like many organotin compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Overall, 1,1′-(1,4-Phenylene)bis[1,1,1-trimethylstannane] is a significant compound in the field of organometallic chemistry, with diverse applications and implications.
Formula:C12H22Sn2
InChI:InChI=1S/C6H4.6CH3.2Sn/c1-2-4-6-5-3-1;;;;;;;;/h1-2,5-6H;6*1H3;;
InChI key:InChIKey=GPZGAMSKANHWHO-UHFFFAOYSA-N
SMILES:[Sn](C)(C)(C)C1=CC=C([Sn](C)(C)C)C=C1
Synonyms:- Tin, p-phenylenebis[trimethyl-
- Stannane, p-phenylenebis[trimethyl-
- Stannane, 1,1′-(1,4-phenylene)bis[1,1,1-trimethyl-
- Stannane, 1,4-phenylenebis[trimethyl-
- 1,1′-(1,4-Phenylene)bis[1,1,1-trimethylstannane]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
