CAS 1012-76-6
:1,2-di-tert-butylbenzene
Description:
1,2-Di-tert-butylbenzene is an organic compound characterized by its structure, which features a benzene ring substituted at the 1 and 2 positions with two tert-butyl groups. This compound is a colorless liquid at room temperature and is known for its relatively high boiling point and low solubility in water, typical of hydrocarbons. The presence of bulky tert-butyl groups imparts significant steric hindrance, influencing its reactivity and making it less prone to electrophilic aromatic substitution compared to other benzene derivatives. 1,2-Di-tert-butylbenzene is primarily used as a chemical intermediate in organic synthesis and may also serve as a solvent or additive in various industrial applications. Its physical properties, such as density and viscosity, are affected by the size and branching of the tert-butyl groups. Additionally, this compound is of interest in studies related to the effects of steric hindrance on chemical reactivity and stability. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure.
Formula:C14H22
InChI:InChI=1/C14H22/c1-13(2,3)11-9-7-8-10-12(11)14(4,5)6/h7-10H,1-6H3
SMILES:CC(C)(C)c1ccccc1C(C)(C)C
Synonyms:- Benzene, 1,2-Bis(1,1-Dimethylethyl)-
- Benzene, bis(1,1-dimethylethyl)-
- Bis(1,1-dimethylethyl)benzene
- 1,2-Di-tert-butylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
o-Di-tert-butylbenzene
CAS:Controlled ProductFormula:C14H22Color and Shape:NeatMolecular weight:190.325

