CAS 1012-84-6: Pentachlorobenzoic acid
Description:Pentachlorobenzoic acid is an aromatic compound characterized by the presence of five chlorine atoms attached to a benzoic acid structure. Its molecular formula is C7Cl5O2, indicating a high degree of chlorination, which significantly influences its chemical properties and behavior. This compound appears as a white crystalline solid and is known for its low solubility in water, while being more soluble in organic solvents. Pentachlorobenzoic acid is primarily used as an herbicide and a biocide, reflecting its role in agricultural applications. Due to the presence of multiple chlorine atoms, it exhibits high stability and resistance to degradation, which raises environmental concerns regarding its persistence and potential bioaccumulation. Additionally, it can undergo various chemical reactions, including nucleophilic substitution and hydrolysis, under specific conditions. Safety considerations are paramount when handling this substance, as it may pose health risks, including toxicity to aquatic organisms and potential carcinogenic effects. Proper precautions and regulatory measures are essential to mitigate its environmental impact.
Formula:C7HCl5O2
InChI:InChI=1S/C7HCl5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h(H,13,14)
InChI key:InChIKey=IONYGGJUUJFXJK-UHFFFAOYSA-N
SMILES:O=C(O)C=1C(Cl)=C(Cl)C(Cl)=C(Cl)C1Cl
- Synonyms:
- 2,3,4,5,6-Pentachlorobenzoic acid
- Benzoic acid, 2,3,4,5,6-pentachloro-
- Benzoic acid, pentachloro-
- NSC 155867
- Pentachloro-Benzoicaci
- Pentachlorobenzoicacid
- Perchlorobenzoic acid
- Perchlorobenzoicacid
- Pentachlorobenzoic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Benzoic acid, 2,3,4,5,6-pentachloro- REF: IN-DA0003XMCAS: 1012-84-6 | - - - | To inquire | Wed 26 Mar 25 |
![]() | 2,3,4,5,6-Pentachloro Benzoic Acid REF: 4Z-B-085198CAS: 1012-84-6 | - - - | To inquire | Wed 02 Apr 25 |
![]() | Pentachlorobenzoic Acid REF: TR-C382783CAS: 1012-84-6 | - - - | 1,547.00 € | Tue 06 May 25 |
![]() | 2,3,4,5,6-Pentachlorobenzoic acid REF: 10-F677724CAS: 1012-84-6 | 96% | - - - | Discontinued product |
![]() | 2,3,4,5,6-Pentachloro-benzoic acid REF: 3D-BAA01284CAS: 1012-84-6 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA0003XM
Undefined size | To inquire |

Ref: 4Z-B-085198
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

Pentachlorobenzoic Acid
Controlled ProductRef: TR-C382783
1g | 1,547.00 € |

Ref: 10-F677724
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

2,3,4,5,6-Pentachloro-benzoic acid
Ref: 3D-BAA01284
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |