CAS 10120-30-6
:α-Phenyl-N-[2-(1-piperidinyl)ethyl]benzeneacetamide
Description:
α-Phenyl-N-[2-(1-piperidinyl)ethyl]benzeneacetamide, with the CAS number 10120-30-6, is a chemical compound that belongs to the class of amides. It features a phenyl group and a piperidine moiety, which contribute to its pharmacological properties. This compound is characterized by its structural complexity, incorporating both aromatic and aliphatic components. The presence of the piperidine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Typically, such compounds may exhibit various biological activities, including analgesic or anti-inflammatory effects, although specific activity can vary based on structural modifications and the presence of substituents. The compound is likely to be soluble in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. As with many amides, it may participate in hydrogen bonding, affecting its solubility and reactivity. Overall, α-Phenyl-N-[2-(1-piperidinyl)ethyl]benzeneacetamide represents a class of compounds that can be explored for therapeutic applications, pending further research and evaluation.
Formula:C21H26N2O
InChI:InChI=1S/C21H26N2O/c24-21(22-14-17-23-15-8-3-9-16-23)20(18-10-4-1-5-11-18)19-12-6-2-7-13-19/h1-2,4-7,10-13,20H,3,8-9,14-17H2,(H,22,24)
InChI key:InChIKey=MWYOFPSSMVPDDI-UHFFFAOYSA-N
SMILES:C(C(NCCN1CCCCC1)=O)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- α-Phenyl-N-[2-(1-piperidinyl)ethyl]benzeneacetamide
- Acetamide, 2,2-diphenyl-N-(2-piperidinoethyl)-
- 2,2-Diphenyl-N-(2-piperidin-1-yl-ethyl)-acetamide
- Benzeneacetamide, α-phenyl-N-[2-(1-piperidinyl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
